C9H10N4OS2 — CID 139636454
1-ethyl-1,3-bis(1,3-thiazol-2-yl)urea (PubChem CID 139636454) has the molecular formula C9H10N4OS2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-ethyl-1,3-bis(1,3-thiazol-2-yl)urea.
| Compound Name | 1-ethyl-1,3-bis(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 139636454 |
| Molecular Formula | C9H10N4OS2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-ethyl-1,3-bis(1,3-thiazol-2-yl)urea |
| SMILES | CCN(C(=O)Nc1nccs1)c1nccs1 |
| InChI | InChI=1S/C9H10N4OS2/c1-2-13(9-11-4-6-16-9)8(14)12-7-10-3-5-15-7/h3-6H,2H2,1H3,(H,10,12,14) |
| InChIKey | NBBBLINMCQJXTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |