C16H22ClN3OS — CID 174565601
chlorobenzene;1-ethyl-1-(2-methylpropyl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 174565601) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is chlorobenzene;1-ethyl-1-(2-methylpropyl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | chlorobenzene;1-ethyl-1-(2-methylpropyl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 174565601 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | chlorobenzene;1-ethyl-1-(2-methylpropyl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CCN(CC(C)C)C(=O)Nc1nccs1.Clc1ccccc1 |
| InChI | InChI=1S/C10H17N3OS.C6H5Cl/c1-4-13(7-8(2)3)10(14)12-9-11-5-6-15-9;7-6-4-2-1-3-5-6/h5-6,8H,4,7H2,1-3H3,(H,11,12,14);1-5H |
| InChIKey | LFFIIXBCZHHGMN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |