C8H11N3O3S — CID 62625896
2-[methyl(1,3-thiazol-2-ylcarbamoyl)amino]propanoic acid (PubChem CID 62625896) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-2-ylcarbamoyl)amino]propanoic acid.
| Compound Name | 2-[methyl(1,3-thiazol-2-ylcarbamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62625896 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-[methyl(1,3-thiazol-2-ylcarbamoyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H11N3O3S/c1-5(6(12)13)11(2)8(14)10-7-9-3-4-15-7/h3-5H,1-2H3,(H,12,13)(H,9,10,14) |
| InChIKey | FKPGBWQAFZFCEZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |