molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide

C5H8N2OS — CID 143921220

IUPACmolecular hydrogen;N-(1,3-thiazol-2-yl)acetamide
SMILESCC(=O)Nc1nccs1.[H][H]
InChIInChI=1S/C5H6N2OS.H2/c1-4(8)7-5-6-2-3-9-5;/h2-3H,1H3,(H,6,7,8);1H
InChIKeyMLNJYAQGQMREAI-UHFFFAOYSA-N
MW144.20 g/mol
LogP1.35
Rot. Bonds1

About molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide

molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide (PubChem CID 143921220) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide.

Molecular Properties

Compound Namemolecular hydrogen;N-(1,3-thiazol-2-yl)acetamide
PubChem CID143921220
Molecular FormulaC5H8N2OS
Molecular Weight144.20 g/mol
Exact Mass144.04
IUPAC Namemolecular hydrogen;N-(1,3-thiazol-2-yl)acetamide
SMILESCC(=O)Nc1nccs1.[H][H]
InChIInChI=1S/C5H6N2OS.H2/c1-4(8)7-5-6-2-3-9-5;/h2-3H,1H3,(H,6,7,8);1H
InChIKeyMLNJYAQGQMREAI-UHFFFAOYSA-N
XLogP1.35
TPSA41.99 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.20
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide (CID 143921220) is molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide is CC(=O)Nc1nccs1.[H][H].
What is the InChIKey of molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is MLNJYAQGQMREAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS.H2/c1-4(8)7-5-6-2-3-9-5;/h2-3H,1H3,(H,6,7,8);1H.
What are the key properties of molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide?
molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 144.20 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 143921220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).