C5H8N2OS — CID 143921220
molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide (PubChem CID 143921220) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 143921220 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | molecular hydrogen;N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nccs1.[H][H] |
| InChI | InChI=1S/C5H6N2OS.H2/c1-4(8)7-5-6-2-3-9-5;/h2-3H,1H3,(H,6,7,8);1H |
| InChIKey | MLNJYAQGQMREAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |