C7H10N4O2S — CID 129281286
3-(2-methylhydrazinyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 129281286) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-(2-methylhydrazinyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(2-methylhydrazinyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 129281286 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-(2-methylhydrazinyl)-3-oxo-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CNNC(=O)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H10N4O2S/c1-8-11-6(13)4-5(12)10-7-9-2-3-14-7/h2-3,8H,4H2,1H3,(H,11,13)(H,9,10,12) |
| InChIKey | LKIDKQNOGAKYPN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|