C8H10N2O2S — CID 59660018
3-oxo-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 59660018) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 3-oxo-N-(1,3-thiazol-2-yl)pentanamide.
| Compound Name | 3-oxo-N-(1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 59660018 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-oxo-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | CCC(=O)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H10N2O2S/c1-2-6(11)5-7(12)10-8-9-3-4-13-8/h3-4H,2,5H2,1H3,(H,9,10,12) |
| InChIKey | OWCNPZAJDASURY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|