C12H10N4O2S2 — CID 2313436
cis-(1R,2S)-3-methylidene-1-N,2-N-bis(1,3-thiazol-2-yl)cyclopropane-1,2-dicarboxamide (PubChem CID 2313436) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is cis-(1R,2S)-3-methylidene-1-N,2-N-bis(1,3-thiazol-2-yl)cyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-3-methylidene-1-N,2-N-bis(1,3-thiazol-2-yl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2313436 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | cis-(1R,2S)-3-methylidene-1-N,2-N-bis(1,3-thiazol-2-yl)cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1[C@H](C(=O)Nc2nccs2)[C@@H]1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H10N4O2S2/c1-6-7(9(17)15-11-13-2-4-19-11)8(6)10(18)16-12-14-3-5-20-12/h2-5,7-8H,1H2,(H,13,15,17)(H,14,16,18)/t7-,8+ |
| InChIKey | JFUCXESYPMLJPO-OCAPTIKFSA-N |
| XLogP | 1.98 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|