C14H16Cl2N2OS — CID 98506991
(1R,4S,6R,9R)-10,10-dichloro-N-(1,3-thiazol-2-yl)tricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 98506991) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is (1R,4S,6R,9R)-10,10-dichloro-N-(1,3-thiazol-2-yl)tricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | (1R,4S,6R,9R)-10,10-dichloro-N-(1,3-thiazol-2-yl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 98506991 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (1R,4S,6R,9R)-10,10-dichloro-N-(1,3-thiazol-2-yl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | O=C(Nc1nccs1)C1[C@H]2CC[C@@H]3[C@@H](CC[C@@H]12)C3(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2N2OS/c15-14(16)9-3-1-7-8(2-4-10(9)14)11(7)12(19)18-13-17-5-6-20-13/h5-11H,1-4H2,(H,17,18,19)/t7-,8+,9-,10-,11?/m1/s1 |
| InChIKey | IRMDTKFPRBMPDC-SJWJCTCFSA-N |
| XLogP | 3.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|