C17H17Cl4NO — CID 98229321
(1R,4R,6R,9R)-10,10-dichloro-N-(3,4-dichlorophenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 98229321) has the molecular formula C17H17Cl4NO and a molecular weight of 393.14 g/mol. Its IUPAC name is (1R,4R,6R,9R)-10,10-dichloro-N-(3,4-dichlorophenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | (1R,4R,6R,9R)-10,10-dichloro-N-(3,4-dichlorophenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 98229321 |
| Molecular Formula | C17H17Cl4NO |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (1R,4R,6R,9R)-10,10-dichloro-N-(3,4-dichlorophenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1[C@@H]2CC[C@@H]3[C@@H](CC[C@@H]12)C3(Cl)Cl |
| InChI | InChI=1S/C17H17Cl4NO/c18-13-6-1-8(7-14(13)19)22-16(23)15-9-2-4-11-12(17(11,20)21)5-3-10(9)15/h1,6-7,9-12,15H,2-5H2,(H,22,23)/t9-,10-,11-,12-/m1/s1 |
| InChIKey | BFBWEKPADQPKTF-DDHJBXDOSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|