C19H23Cl2NO — CID 2928549
10,10-dichloro-N-(3,5-dimethylphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 2928549) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is 10,10-dichloro-N-(3,5-dimethylphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | 10,10-dichloro-N-(3,5-dimethylphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 2928549 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 10,10-dichloro-N-(3,5-dimethylphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2C3CCC4C(CCC32)C4(Cl)Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO/c1-10-7-11(2)9-12(8-10)22-18(23)17-13-3-5-15-16(19(15,20)21)6-4-14(13)17/h7-9,13-17H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | NXNYJRGLJXXUIN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|