C19H23Cl2NO2 — CID 2894969
10,10-dichloro-N-(2-ethoxyphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 2894969) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is 10,10-dichloro-N-(2-ethoxyphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | 10,10-dichloro-N-(2-ethoxyphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 2894969 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 10,10-dichloro-N-(2-ethoxyphenyl)tricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1C2CCC3C(CCC21)C3(Cl)Cl |
| InChI | InChI=1S/C19H23Cl2NO2/c1-2-24-16-6-4-3-5-15(16)22-18(23)17-11-7-9-13-14(19(13,20)21)10-8-12(11)17/h3-6,11-14,17H,2,7-10H2,1H3,(H,22,23) |
| InChIKey | DZBNRLJJOLPANB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|