C18H23NO2 — CID 100882580
(1R,8S,9S)-N-(2-ethoxyphenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide (PubChem CID 100882580) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1R,8S,9S)-N-(2-ethoxyphenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide.
| Compound Name | (1R,8S,9S)-N-(2-ethoxyphenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide |
|---|---|
| PubChem CID | 100882580 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1R,8S,9S)-N-(2-ethoxyphenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H]1[C@@H]2C=CCCCC[C@@H]21 |
| InChI | InChI=1S/C18H23NO2/c1-2-21-16-12-8-7-11-15(16)19-18(20)17-13-9-5-3-4-6-10-14(13)17/h5,7-9,11-14,17H,2-4,6,10H2,1H3,(H,19,20)/t13-,14+,17-/m1/s1 |
| InChIKey | ZRVMNDIIRNBUOD-JKIFEVAISA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|