C20H24NO3- — CID 11906999
(1S,2S,3S,4R)-3-[(3,5-dimethylphenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11906999) has the molecular formula C20H24NO3- and a molecular weight of 326.42 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(3,5-dimethylphenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2S,3S,4R)-3-[(3,5-dimethylphenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11906999 |
| Molecular Formula | C20H24NO3- |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(3,5-dimethylphenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@H](C(=O)Nc1cc(C)cc(C)c1)[C@H]2C(=O)[O-] |
| InChI | InChI=1S/C20H25NO3/c1-10(2)16-14-5-6-15(16)18(20(23)24)17(14)19(22)21-13-8-11(3)7-12(4)9-13/h7-9,14-15,17-18H,5-6H2,1-4H3,(H,21,22)(H,23,24)/p-1/t14-,15+,17-,18-/m0/s1 |
| InChIKey | WLUUNDKHYAJMCU-MVJTYMMSSA-M |
| XLogP | 2.60 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|