C14H17NO4 — CID 102944368
(2R,5S)-5-[(3,5-dimethylphenyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 102944368) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2R,5S)-5-[(3,5-dimethylphenyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-[(3,5-dimethylphenyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102944368 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2R,5S)-5-[(3,5-dimethylphenyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@H]2CC[C@H](C(=O)O)O2)c1 |
| InChI | InChI=1S/C14H17NO4/c1-8-5-9(2)7-10(6-8)15-13(16)11-3-4-12(19-11)14(17)18/h5-7,11-12H,3-4H2,1-2H3,(H,15,16)(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | GUPDDHSOVCHZDK-NWDGAFQWSA-N |
| XLogP | 1.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |