C12H11Cl2NO5 — CID 107677682
(2R,5S)-5-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 107677682) has the molecular formula C12H11Cl2NO5 and a molecular weight of 320.13 g/mol. Its IUPAC name is (2R,5S)-5-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 107677682 |
| Molecular Formula | C12H11Cl2NO5 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (2R,5S)-5-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C12H11Cl2NO5/c13-6-3-5(4-7(14)10(6)16)15-11(17)8-1-2-9(20-8)12(18)19/h3-4,8-9,16H,1-2H2,(H,15,17)(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | YKCGMWRXTXKBJS-DTWKUNHWSA-N |
| XLogP | 2.27 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|