C12H11ClN2O6 — CID 102944727
(2R,5S)-5-[(2-chloro-5-nitrophenyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 102944727) has the molecular formula C12H11ClN2O6 and a molecular weight of 314.68 g/mol. Its IUPAC name is (2R,5S)-5-[(2-chloro-5-nitrophenyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-[(2-chloro-5-nitrophenyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102944727 |
| Molecular Formula | C12H11ClN2O6 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (2R,5S)-5-[(2-chloro-5-nitrophenyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C12H11ClN2O6/c13-7-2-1-6(15(19)20)5-8(7)14-11(16)9-3-4-10(21-9)12(17)18/h1-2,5,9-10H,3-4H2,(H,14,16)(H,17,18)/t9-,10+/m0/s1 |
| InChIKey | OXCBLGJPPJOPQG-VHSXEESVSA-N |
| XLogP | 1.82 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|