C11H11ClN2O4 — CID 102945567
(2R,5S)-5-[(6-chloro-3-pyridinyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 102945567) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is (2R,5S)-5-[(6-chloro-3-pyridinyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-[(6-chloro-3-pyridinyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945567 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2R,5S)-5-[(6-chloro-3-pyridinyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(Cl)nc1)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C11H11ClN2O4/c12-9-4-1-6(5-13-9)14-10(15)7-2-3-8(18-7)11(16)17/h1,4-5,7-8H,2-3H2,(H,14,15)(H,16,17)/t7-,8+/m0/s1 |
| InChIKey | MWIHCTJMKTWSDZ-JGVFFNPUSA-N |
| XLogP | 1.31 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|