C18H18F2NO3- — CID 11903140
(1R,2S,3R,4S)-3-[(2,5-difluorophenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11903140) has the molecular formula C18H18F2NO3- and a molecular weight of 334.34 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(2,5-difluorophenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-[(2,5-difluorophenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11903140 |
| Molecular Formula | C18H18F2NO3- |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(2,5-difluorophenyl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@H](C(=O)[O-])[C@@H]2C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H19F2NO3/c1-8(2)14-10-4-5-11(14)16(18(23)24)15(10)17(22)21-13-7-9(19)3-6-12(13)20/h3,6-7,10-11,15-16H,4-5H2,1-2H3,(H,21,22)(H,23,24)/p-1/t10-,11+,15-,16+/m1/s1 |
| InChIKey | KAEWQPOVWLJIJJ-CJTUPEFNSA-M |
| XLogP | 2.26 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|