C12H12Cl2N2O — CID 79210508
4-amino-N-(3,4-dichlorophenyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79210508) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 4-amino-N-(3,4-dichlorophenyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(3,4-dichlorophenyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79210508 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4-amino-N-(3,4-dichlorophenyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H12Cl2N2O/c13-10-4-3-9(6-11(10)14)16-12(17)7-1-2-8(15)5-7/h1-4,6-8H,5,15H2,(H,16,17) |
| InChIKey | WDWOLZQXLBQPPT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|