C15H15N3O — CID 79207327
4-amino-N-quinolin-6-ylcyclopent-2-ene-1-carboxamide (PubChem CID 79207327) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-amino-N-quinolin-6-ylcyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-quinolin-6-ylcyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79207327 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-amino-N-quinolin-6-ylcyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)Nc2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C15H15N3O/c16-12-4-3-11(8-12)15(19)18-13-5-6-14-10(9-13)2-1-7-17-14/h1-7,9,11-12H,8,16H2,(H,18,19) |
| InChIKey | IQSZBQFOWBZORB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|