C19H21Cl2NO2 — CID 11896358
(1S,4R,6R,9R)-N-(3-acetylphenyl)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 11896358) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is (1S,4R,6R,9R)-N-(3-acetylphenyl)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | (1S,4R,6R,9R)-N-(3-acetylphenyl)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 11896358 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (1S,4R,6R,9R)-N-(3-acetylphenyl)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2[C@@H]3CC[C@@H]4[C@H](CC[C@@H]23)C4(Cl)Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO2/c1-10(23)11-3-2-4-12(9-11)22-18(24)17-13-5-7-15-16(19(15,20)21)8-6-14(13)17/h2-4,9,13-17H,5-8H2,1H3,(H,22,24)/t13-,14-,15-,16+,17?/m1/s1 |
| InChIKey | WVWXYSKLKDXZJF-DNLWUEFJSA-N |
| XLogP | 4.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|