C12H11Cl2NO2 — CID 18082486
N-(3-acetylphenyl)-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 18082486) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 18082486 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | N-(3-acetylphenyl)-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NO2/c1-7(16)8-3-2-4-9(5-8)15-11(17)10-6-12(10,13)14/h2-5,10H,6H2,1H3,(H,15,17) |
| InChIKey | FFEHMITXKYWOMS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|