C12H14BrNO — CID 103837156
N-(3-bromophenyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 103837156) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is N-(3-bromophenyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-(3-bromophenyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103837156 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-(3-bromophenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrNO/c1-12(2)7-10(12)11(15)14-9-5-3-4-8(13)6-9/h3-6,10H,7H2,1-2H3,(H,14,15) |
| InChIKey | OTEMLUGJONNUPZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |