C11H8BrN3O4 — CID 134157564
N-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 134157564) has the molecular formula C11H8BrN3O4 and a molecular weight of 326.11 g/mol. Its IUPAC name is N-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134157564 |
| Molecular Formula | C11H8BrN3O4 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | N-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)C(C(=O)Nc2cccc(Br)c2)C(=O)N1 |
| InChI | InChI=1S/C11H8BrN3O4/c12-5-2-1-3-6(4-5)13-8(16)7-9(17)14-11(19)15-10(7)18/h1-4,7H,(H,13,16)(H2,14,15,17,18,19) |
| InChIKey | PALJSLXDXXYNNS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|