C18H14Br2N2O2 — CID 1120968
trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide (PubChem CID 1120968) has the molecular formula C18H14Br2N2O2 and a molecular weight of 450.13 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1120968 |
| Molecular Formula | C18H14Br2N2O2 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
| SMILES | C=C1[C@H](C(=O)Nc2cccc(Br)c2)[C@H]1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H14Br2N2O2/c1-10-15(17(23)21-13-6-2-4-11(19)8-13)16(10)18(24)22-14-7-3-5-12(20)9-14/h2-9,15-16H,1H2,(H,21,23)(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | OUJAPLYUMRYGKX-HOTGVXAUSA-N |
| XLogP | 4.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|