C12H11BrN2O3 — CID 139526446
N-(3-bromophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 139526446) has the molecular formula C12H11BrN2O3 and a molecular weight of 311.14 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 139526446 |
| Molecular Formula | C12H11BrN2O3 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | N-(3-bromophenyl)-4-methyl-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CC1C(=O)NC(=O)C1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H11BrN2O3/c1-6-9(12(18)15-10(6)16)11(17)14-8-4-2-3-7(13)5-8/h2-6,9H,1H3,(H,14,17)(H,15,16,18) |
| InChIKey | XDBQWACASQHMBM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|