C12H15BrN2O — CID 18073202
N-(3-bromophenyl)piperidine-2-carboxamide (PubChem CID 18073202) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is N-(3-bromophenyl)piperidine-2-carboxamide.
| Compound Name | N-(3-bromophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 18073202 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-(3-bromophenyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CCCCN1 |
| InChI | InChI=1S/C12H15BrN2O/c13-9-4-3-5-10(8-9)15-12(16)11-6-1-2-7-14-11/h3-5,8,11,14H,1-2,6-7H2,(H,15,16) |
| InChIKey | PTNPAQJWLAGXDU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |