C13H16N2O3 — CID 104913517
3-[[(2R)-piperidine-2-carbonyl]amino]benzoic acid (PubChem CID 104913517) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[[(2R)-piperidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[(2R)-piperidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 104913517 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-[[(2R)-piperidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)[C@H]2CCCCN2)c1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(11-6-1-2-7-14-11)15-10-5-3-4-9(8-10)13(17)18/h3-5,8,11,14H,1-2,6-7H2,(H,15,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | QZVAQGDWUWVKLB-LLVKDONJSA-N |
| XLogP | 1.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |