C22H16BrNO — CID 1108038
N-(3-bromophenyl)-2,3-diphenylcycloprop-2-ene-1-carboxamide (PubChem CID 1108038) has the molecular formula C22H16BrNO and a molecular weight of 390.28 g/mol. Its IUPAC name is N-(3-bromophenyl)-2,3-diphenylcycloprop-2-ene-1-carboxamide.
| Compound Name | N-(3-bromophenyl)-2,3-diphenylcycloprop-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 1108038 |
| Molecular Formula | C22H16BrNO |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N-(3-bromophenyl)-2,3-diphenylcycloprop-2-ene-1-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C22H16BrNO/c23-17-12-7-13-18(14-17)24-22(25)21-19(15-8-3-1-4-9-15)20(21)16-10-5-2-6-11-16/h1-14,21H,(H,24,25) |
| InChIKey | NVQQMOLNIISBRT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|