C13H17BrN2O — CID 175623631
(2S)-N-(3-bromophenyl)-1,4-dimethylpyrrolidine-2-carboxamide (PubChem CID 175623631) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is (2S)-N-(3-bromophenyl)-1,4-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-bromophenyl)-1,4-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175623631 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (2S)-N-(3-bromophenyl)-1,4-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC1C[C@@H](C(=O)Nc2cccc(Br)c2)N(C)C1 |
| InChI | InChI=1S/C13H17BrN2O/c1-9-6-12(16(2)8-9)13(17)15-11-5-3-4-10(14)7-11/h3-5,7,9,12H,6,8H2,1-2H3,(H,15,17)/t9?,12-/m0/s1 |
| InChIKey | DMQIAWXNCJSAED-ACGXKRRESA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |