C12H13BrN2O — CID 168753842
N-(3-bromophenyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 168753842) has the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 168753842 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N-(3-bromophenyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CC2CC2N1 |
| InChI | InChI=1S/C12H13BrN2O/c13-8-2-1-3-9(6-8)14-12(16)11-5-7-4-10(7)15-11/h1-3,6-7,10-11,15H,4-5H2,(H,14,16) |
| InChIKey | BGGMLROPDABIMX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |