C11H11BrFN3O — CID 166518234
(1R,3S,5R)-N-(6-bromo-3-fluoro-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 166518234) has the molecular formula C11H11BrFN3O and a molecular weight of 300.13 g/mol. Its IUPAC name is (1R,3S,5R)-N-(6-bromo-3-fluoro-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-N-(6-bromo-3-fluoro-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 166518234 |
| Molecular Formula | C11H11BrFN3O |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | (1R,3S,5R)-N-(6-bromo-3-fluoro-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(Nc1nc(Br)ccc1F)[C@@H]1C[C@H]2C[C@H]2N1 |
| InChI | InChI=1S/C11H11BrFN3O/c12-9-2-1-6(13)10(15-9)16-11(17)8-4-5-3-7(5)14-8/h1-2,5,7-8,14H,3-4H2,(H,15,16,17)/t5-,7-,8+/m1/s1 |
| InChIKey | MHUFZGKDSHLTTR-NJUXHZRNSA-N |
| XLogP | 1.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|