C14H18BrN3O — CID 135318621
(3S)-N-(6-bromo-3-methyl-2-pyridinyl)-2-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 135318621) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is (3S)-N-(6-bromo-3-methyl-2-pyridinyl)-2-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3S)-N-(6-bromo-3-methyl-2-pyridinyl)-2-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 135318621 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (3S)-N-(6-bromo-3-methyl-2-pyridinyl)-2-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | Cc1ccc(Br)nc1NC(=O)[C@H]1NC2CCC1CC2 |
| InChI | InChI=1S/C14H18BrN3O/c1-8-2-7-11(15)17-13(8)18-14(19)12-9-3-5-10(16-12)6-4-9/h2,7,9-10,12,16H,3-6H2,1H3,(H,17,18,19)/t9?,10?,12-/m0/s1 |
| InChIKey | SSMVWBQRWPLYOL-CBINBANVSA-N |
| XLogP | 2.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|