C12H15BrN3O+ — CID 142495938
(1R,3S,4S)-N-(6-bromopyridin-1-ium-2-yl)-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 142495938) has the molecular formula C12H15BrN3O+ and a molecular weight of 297.18 g/mol. Its IUPAC name is (1R,3S,4S)-N-(6-bromopyridin-1-ium-2-yl)-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S,4S)-N-(6-bromopyridin-1-ium-2-yl)-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 142495938 |
| Molecular Formula | C12H15BrN3O+ |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (1R,3S,4S)-N-(6-bromopyridin-1-ium-2-yl)-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)[nH+]1)[C@H]1N[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H14BrN3O/c13-9-2-1-3-10(15-9)16-12(17)11-7-4-5-8(6-7)14-11/h1-3,7-8,11,14H,4-6H2,(H,15,16,17)/p+1/t7-,8+,11-/m0/s1 |
| InChIKey | YBRKQHNTLRHXRR-RNSXUZJQSA-O |
| XLogP | 1.34 |
| TPSA | 55.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|