C16H18IN3O — CID 130281043
(1R,3S)-N-[(1S)-1-cyano-2-(4-iodophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 130281043) has the molecular formula C16H18IN3O and a molecular weight of 395.24 g/mol. Its IUPAC name is (1R,3S)-N-[(1S)-1-cyano-2-(4-iodophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S)-N-[(1S)-1-cyano-2-(4-iodophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 130281043 |
| Molecular Formula | C16H18IN3O |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (1R,3S)-N-[(1S)-1-cyano-2-(4-iodophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(I)cc1)NC(=O)[C@H]1N[C@@H]2CCC1C2 |
| InChI | InChI=1S/C16H18IN3O/c17-12-4-1-10(2-5-12)7-14(9-18)20-16(21)15-11-3-6-13(8-11)19-15/h1-2,4-5,11,13-15,19H,3,6-8H2,(H,20,21)/t11?,13-,14+,15+/m1/s1 |
| InChIKey | RECLFOBPKIHVMF-VAUYPLMASA-N |
| XLogP | 1.98 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|