C23H31N5O — CID 89472119
(1R,3S,4S)-N-[(1S)-2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-1-cyanoethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 89472119) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is (1R,3S,4S)-N-[(1S)-2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-1-cyanoethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S,4S)-N-[(1S)-2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-1-cyanoethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 89472119 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (1R,3S,4S)-N-[(1S)-2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-1-cyanoethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(N2CCN3CCCC3C2)cc1)NC(=O)[C@H]1N[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C23H31N5O/c24-14-19(26-23(29)22-17-5-6-18(13-17)25-22)12-16-3-7-20(8-4-16)28-11-10-27-9-1-2-21(27)15-28/h3-4,7-8,17-19,21-22,25H,1-2,5-6,9-13,15H2,(H,26,29)/t17-,18+,19-,21?,22-/m0/s1 |
| InChIKey | XPPWTJHJOODJQQ-GAHNEVOTSA-N |
| XLogP | 1.66 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|