C25H32FN5O2 — CID 140700143
N-[(1S)-1-cyano-2-[2-fluoro-4-[2-(oxetan-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 140700143) has the molecular formula C25H32FN5O2 and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2-[2-fluoro-4-[2-(oxetan-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | N-[(1S)-1-cyano-2-[2-fluoro-4-[2-(oxetan-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 140700143 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-[(1S)-1-cyano-2-[2-fluoro-4-[2-(oxetan-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(N2CC3CN(C4COC4)CC3C2)cc1F)NC(=O)C1NC2CCC1C2 |
| InChI | InChI=1S/C25H32FN5O2/c26-23-7-21(30-9-17-11-31(12-18(17)10-30)22-13-33-14-22)4-2-15(23)5-20(8-27)29-25(32)24-16-1-3-19(6-16)28-24/h2,4,7,16-20,22,24,28H,1,3,5-6,9-14H2,(H,29,32)/t16?,17?,18?,19?,20-,24?/m0/s1 |
| InChIKey | QDOMJHKQLLCXPP-JHUXHLEVSA-N |
| XLogP | 1.28 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |