C23H30FN5O — CID 144701107
N-[(1S)-1-cyano-2-[2-fluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 144701107) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2-[2-fluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | N-[(1S)-1-cyano-2-[2-fluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 144701107 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N-[(1S)-1-cyano-2-[2-fluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | CN1CC2CCN(c3ccc(C[C@@H](C#N)NC(=O)C4NC5CCC4C5)c(F)c3)C2C1 |
| InChI | InChI=1S/C23H30FN5O/c1-28-12-16-6-7-29(21(16)13-28)19-5-3-14(20(24)10-19)8-18(11-25)27-23(30)22-15-2-4-17(9-15)26-22/h3,5,10,15-18,21-22,26H,2,4,6-9,12-13H2,1H3,(H,27,30)/t15?,16?,17?,18-,21?,22?/m0/s1 |
| InChIKey | HEZSCOPWBZQUPX-FQKRMZDOSA-N |
| XLogP | 1.66 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |