C24H24N4O — CID 123600134
N-[1-cyano-2-[4-(1H-indol-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 123600134) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[1-cyano-2-[4-(1H-indol-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | N-[1-cyano-2-[4-(1H-indol-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 123600134 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[1-cyano-2-[4-(1H-indol-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | N#CC(Cc1ccc(-c2ccc3cc[nH]c3c2)cc1)NC(=O)C1NC2CCC1C2 |
| InChI | InChI=1S/C24H24N4O/c25-14-21(28-24(29)23-19-7-8-20(12-19)27-23)11-15-1-3-16(4-2-15)18-6-5-17-9-10-26-22(17)13-18/h1-6,9-10,13,19-21,23,26-27H,7-8,11-12H2,(H,28,29) |
| InChIKey | TXSYUOVLJSCAFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |