C24H24N4O3 — CID 89471941
(1R,3S,4S)-N-[(1S)-1-cyano-2-[4-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 89471941) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is (1R,3S,4S)-N-[(1S)-1-cyano-2-[4-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S,4S)-N-[(1S)-1-cyano-2-[4-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 89471941 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (1R,3S,4S)-N-[(1S)-1-cyano-2-[4-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(-c2ccc3c(c2)COC(=O)N3)cc1)NC(=O)[C@H]1N[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C24H24N4O3/c25-12-20(27-23(29)22-17-5-7-19(11-17)26-22)9-14-1-3-15(4-2-14)16-6-8-21-18(10-16)13-31-24(30)28-21/h1-4,6,8,10,17,19-20,22,26H,5,7,9,11,13H2,(H,27,29)(H,28,30)/t17-,19+,20-,22-/m0/s1 |
| InChIKey | BHRJSOSRCBYVQE-UFGBVDADSA-N |
| XLogP | 3.11 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |