C7H10ClNO — CID 57358634
(1S,3R,4R)-2-azabicyclo[2.2.1]heptane-3-carbonyl chloride (PubChem CID 57358634) has the molecular formula C7H10ClNO and a molecular weight of 159.62 g/mol. Its IUPAC name is (1S,3R,4R)-2-azabicyclo[2.2.1]heptane-3-carbonyl chloride.
| Compound Name | (1S,3R,4R)-2-azabicyclo[2.2.1]heptane-3-carbonyl chloride |
|---|---|
| PubChem CID | 57358634 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (1S,3R,4R)-2-azabicyclo[2.2.1]heptane-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1N[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C7H10ClNO/c8-7(10)6-4-1-2-5(3-4)9-6/h4-6,9H,1-3H2/t4-,5+,6-/m1/s1 |
| InChIKey | YFLOEGCHJQLXKA-NGJCXOISSA-N |
| XLogP | 0.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|