C11H12BrN3O — CID 126653838
(1R,2S,5S)-N-(6-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 126653838) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is (1R,2S,5S)-N-(6-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(6-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 126653838 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | (1R,2S,5S)-N-(6-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)n1)[C@H]1NC[C@H]2C[C@H]21 |
| InChI | InChI=1S/C11H12BrN3O/c12-8-2-1-3-9(14-8)15-11(16)10-7-4-6(7)5-13-10/h1-3,6-7,10,13H,4-5H2,(H,14,15,16)/t6-,7-,10+/m1/s1 |
| InChIKey | OWRMVCFOHXVPJR-XSSZXYGBSA-N |
| XLogP | 1.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|