C12H13BrFN3O3 — CID 126623416
[2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoropyrrolidin-3-yl] acetate (PubChem CID 126623416) has the molecular formula C12H13BrFN3O3 and a molecular weight of 346.16 g/mol. Its IUPAC name is [2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoropyrrolidin-3-yl] acetate.
| Compound Name | [2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoropyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 126623416 |
| Molecular Formula | C12H13BrFN3O3 |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | [2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoropyrrolidin-3-yl] acetate |
| SMILES | CC(=O)OC1C(F)CNC1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C12H13BrFN3O3/c1-6(18)20-11-7(14)5-15-10(11)12(19)17-9-4-2-3-8(13)16-9/h2-4,7,10-11,15H,5H2,1H3,(H,16,17,19) |
| InChIKey | RELMJIMTLAHYLQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|