C9H8BrN3O2S — CID 43520475
N-(6-bromo-2-pyridinyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 43520475) has the molecular formula C9H8BrN3O2S and a molecular weight of 302.15 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43520475 |
| Molecular Formula | C9H8BrN3O2S |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2cccc(Br)n2)CS1 |
| InChI | InChI=1S/C9H8BrN3O2S/c10-6-2-1-3-7(12-6)13-8(14)5-4-16-9(15)11-5/h1-3,5H,4H2,(H,11,15)(H,12,13,14) |
| InChIKey | CSTUSSBAMPJKOM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|