C10H7BrF2N2O2S — CID 107612421
N-(4-bromo-2,5-difluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 107612421) has the molecular formula C10H7BrF2N2O2S and a molecular weight of 337.15 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 107612421 |
| Molecular Formula | C10H7BrF2N2O2S |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2cc(F)c(Br)cc2F)CS1 |
| InChI | InChI=1S/C10H7BrF2N2O2S/c11-4-1-6(13)7(2-5(4)12)14-9(16)8-3-18-10(17)15-8/h1-2,8H,3H2,(H,14,16)(H,15,17) |
| InChIKey | AQXMKHZKRXNMJD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|