C13H15BrF2N2O — CID 107611804
N-(4-bromo-2,5-difluorophenyl)-4-methylpiperidine-2-carboxamide (PubChem CID 107611804) has the molecular formula C13H15BrF2N2O and a molecular weight of 333.18 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-4-methylpiperidine-2-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 107611804 |
| Molecular Formula | C13H15BrF2N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-4-methylpiperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)Nc2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C13H15BrF2N2O/c1-7-2-3-17-12(4-7)13(19)18-11-6-9(15)8(14)5-10(11)16/h5-7,12,17H,2-4H2,1H3,(H,18,19) |
| InChIKey | BZOMTIXOWLAACR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|