C13H15Br3N2O — CID 114422755
4-methyl-N-(2,4,6-tribromophenyl)piperidine-2-carboxamide (PubChem CID 114422755) has the molecular formula C13H15Br3N2O and a molecular weight of 454.99 g/mol. Its IUPAC name is 4-methyl-N-(2,4,6-tribromophenyl)piperidine-2-carboxamide.
| Compound Name | 4-methyl-N-(2,4,6-tribromophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114422755 |
| Molecular Formula | C13H15Br3N2O |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 451.87 |
| IUPAC Name | 4-methyl-N-(2,4,6-tribromophenyl)piperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)Nc2c(Br)cc(Br)cc2Br)C1 |
| InChI | InChI=1S/C13H15Br3N2O/c1-7-2-3-17-11(4-7)13(19)18-12-9(15)5-8(14)6-10(12)16/h5-7,11,17H,2-4H2,1H3,(H,18,19) |
| InChIKey | LIONYLPSCPWFFB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |