C12H12BrF2NO2 — CID 103842465
N-(4-bromo-2,5-difluorophenyl)-3-methyloxolane-2-carboxamide (PubChem CID 103842465) has the molecular formula C12H12BrF2NO2 and a molecular weight of 320.13 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-3-methyloxolane-2-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 103842465 |
| Molecular Formula | C12H12BrF2NO2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-3-methyloxolane-2-carboxamide |
| SMILES | CC1CCOC1C(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H12BrF2NO2/c1-6-2-3-18-11(6)12(17)16-10-5-8(14)7(13)4-9(10)15/h4-6,11H,2-3H2,1H3,(H,16,17) |
| InChIKey | IBVMFQXJVCBINH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|