C14H16FNO3 — CID 75503564
N-(2-acetyl-5-fluorophenyl)-3-methyloxolane-2-carboxamide (PubChem CID 75503564) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(2-acetyl-5-fluorophenyl)-3-methyloxolane-2-carboxamide.
| Compound Name | N-(2-acetyl-5-fluorophenyl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 75503564 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(2-acetyl-5-fluorophenyl)-3-methyloxolane-2-carboxamide |
| SMILES | CC(=O)c1ccc(F)cc1NC(=O)C1OCCC1C |
| InChI | InChI=1S/C14H16FNO3/c1-8-5-6-19-13(8)14(18)16-12-7-10(15)3-4-11(12)9(2)17/h3-4,7-8,13H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | APOPQZSAHKASCK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |