C11H13FN2O2 — CID 126793790
(2S,3R)-N-(5-fluoro-3-pyridinyl)-3-methyloxolane-2-carboxamide (PubChem CID 126793790) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is (2S,3R)-N-(5-fluoro-3-pyridinyl)-3-methyloxolane-2-carboxamide.
| Compound Name | (2S,3R)-N-(5-fluoro-3-pyridinyl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 126793790 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2S,3R)-N-(5-fluoro-3-pyridinyl)-3-methyloxolane-2-carboxamide |
| SMILES | C[C@@H]1CCO[C@@H]1C(=O)Nc1cncc(F)c1 |
| InChI | InChI=1S/C11H13FN2O2/c1-7-2-3-16-10(7)11(15)14-9-4-8(12)5-13-6-9/h4-7,10H,2-3H2,1H3,(H,14,15)/t7-,10+/m1/s1 |
| InChIKey | AUHHYJOOYHOVCI-XCBNKYQSSA-N |
| XLogP | 1.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |